CAS 915921-46-9

4-methyl-3-[(2-methylpropanoyl)amino]benzoic acid

Description:

4-Methyl-3-[(2-methylpropanoyl)amino]benzoic acid, with the CAS number 915921-46-9, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a methyl group and an amide functional group. This compound features a 4-methyl group at the para position and a 3-amino group that is further substituted with a 2-methylpropanoyl group, contributing to its unique chemical properties. The presence of the carboxylic acid group indicates that it can act as an acid, while the amide linkage suggests potential for hydrogen bonding and increased solubility in polar solvents. Its molecular structure may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the compound's stability, reactivity, and solubility can be influenced by the presence of the methyl and amide groups, which may affect its interactions in various chemical environments. Overall, this compound exemplifies the complexity and diversity of organic molecules in medicinal chemistry.

Formula: C₁₂H₁₅NO₃

InChI: InChI=1/C12H15NO3/c1-7(2)11(14)13-10-6-9(12(15)16)5-4-8(10)3/h4-7H,1-3H3,(H,13,14)(H,15,16)

SMILES: CC(C)C(=Nc1cc(ccc1C)C(=O)O)O

Synonyms:

• Benzoic Acid, 4-Methyl-3-[(2-Methyl-1-Oxopropyl)Amino]-

3-(isobutyrylamino)-4-methylbenzoic acid

CAS: 915921-46-9

Formula: C₁₂H₁₅NO₃

Purity: 95.0%

Molecular weight: 221.256

Ref: 10-F315968