CymitQuimica logo

CAS 915921-47-0

:

N-Ethyl-7-methyl-1H-benzimidazole-2-ethanamine

Description:
N-Ethyl-7-methyl-1H-benzimidazole-2-ethanamine is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with an ethyl group and a methyl group. This compound typically exhibits properties associated with heterocyclic amines, including potential basicity due to the presence of the amine functional group. The benzimidazole moiety is known for its biological activity, often serving as a scaffold in medicinal chemistry. The presence of the ethyl and methyl substituents can influence the compound's solubility, lipophilicity, and overall reactivity. Such compounds may exhibit pharmacological properties, making them of interest in drug development and research. Additionally, the specific arrangement of atoms and functional groups can affect the compound's interaction with biological targets, potentially leading to various therapeutic applications. As with many organic compounds, the stability, reactivity, and behavior of N-Ethyl-7-methyl-1H-benzimidazole-2-ethanamine can be influenced by environmental factors such as pH and temperature.
Formula:C12H17N3
InChI:InChI=1S/C12H17N3/c1-3-13-8-7-11-14-10-6-4-5-9(2)12(10)15-11/h4-6,13H,3,7-8H2,1-2H3,(H,14,15)
InChI key:InChIKey=UMURVKQCFZEOEE-UHFFFAOYSA-N
SMILES:CC1=C2C(NC(CCNCC)=N2)=CC=C1
Synonyms:
  • 1H-Benzimidazole-2-ethanamine, N-ethyl-7-methyl-
  • N-Ethyl-7-methyl-1H-benzimidazole-2-ethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.