CymitQuimica logo

CAS 915921-52-7

:

3-(3,5-Dimethylphenoxy)-N-methyl-1-propanamine

Description:
3-(3,5-Dimethylphenoxy)-N-methyl-1-propanamine, with the CAS number 915921-52-7, is an organic compound characterized by its unique structure, which includes a propanamine backbone substituted with a 3-(3,5-dimethylphenoxy) group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. The dimethylphenoxy moiety contributes to its hydrophobic characteristics, potentially influencing its solubility in organic solvents. The presence of the methyl groups on the aromatic ring can enhance the compound's lipophilicity, which may affect its biological activity and interaction with various receptors or enzymes. Additionally, the compound may exhibit moderate to high stability under standard conditions, but its reactivity can vary depending on the specific environment and functional groups present. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry or as a building block in the synthesis of more complex molecules.
Formula:C12H19NO
InChI:InChI=1S/C12H19NO/c1-10-7-11(2)9-12(8-10)14-6-4-5-13-3/h7-9,13H,4-6H2,1-3H3
InChI key:InChIKey=DKEZRTKRWTWEOL-UHFFFAOYSA-N
SMILES:O(CCCNC)C1=CC(C)=CC(C)=C1
Synonyms:
  • 1-Propanamine, 3-(3,5-dimethylphenoxy)-N-methyl-
  • 3-(3,5-Dimethylphenoxy)-N-methyl-1-propanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.