CAS 915921-54-9
:5-[2-(2,5-dimethylphenoxy)ethyl]-1,3,4-thiadiazol-2-amine
Description:
5-[2-(2,5-Dimethylphenoxy)ethyl]-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and an amine functional group. The presence of the thiadiazole moiety contributes to its potential biological activity, as thiadiazoles are often associated with various pharmacological properties. The compound features a 2,5-dimethylphenoxy group, which enhances its lipophilicity and may influence its interaction with biological targets. This compound is typically synthesized through organic reactions involving thiadiazole derivatives and phenolic compounds. Its applications may span across medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals, due to the presence of both the aromatic and heterocyclic components. The specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. As with many synthetic compounds, safety and handling precautions are essential, and its biological effects would require thorough investigation through experimental studies.
Formula:C12H15N3OS
InChI:InChI=1/C12H15N3OS/c1-8-3-4-9(2)10(7-8)16-6-5-11-14-15-12(13)17-11/h3-4,7H,5-6H2,1-2H3,(H2,13,15)
SMILES:Cc1ccc(C)c(c1)OCCc1n[nH]c(=N)s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.