CymitQuimica logo

CAS 915921-56-1

:

2-(3-ethoxyphenoxy)-N-methyl-ethanamine

Description:
2-(3-Ethoxyphenoxy)-N-methyl-ethanamine, with the CAS number 915921-56-1, is an organic compound characterized by its unique molecular structure, which includes an ethoxy group and a phenoxy moiety attached to a N-methyl-ethanamine backbone. This compound typically exhibits properties such as moderate solubility in organic solvents due to its hydrophobic aromatic components, while potentially showing limited solubility in water. The presence of the amine functional group suggests that it may engage in hydrogen bonding, influencing its reactivity and interaction with other chemical species. Additionally, the ethoxy and phenoxy groups can impart specific electronic and steric effects, which may affect its biological activity and potential applications in pharmaceuticals or agrochemicals. As with many amines, it may also exhibit basicity, allowing it to participate in acid-base reactions. Overall, the characteristics of this compound make it of interest in various fields, including medicinal chemistry and materials science, although specific applications would depend on further research and testing.
Formula:C11H17NO2
InChI:InChI=1/C11H17NO2/c1-3-13-10-5-4-6-11(9-10)14-8-7-12-2/h4-6,9,12H,3,7-8H2,1-2H3
SMILES:CCOc1cccc(c1)OCCNC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.