CymitQuimica logo

CAS 915921-57-2

:

2-(2-Chloroethyl)-6-methyl-1H-benzimidazole

Description:
2-(2-Chloroethyl)-6-methyl-1H-benzimidazole is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a chloroethyl group, which enhances its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the methyl group at the 6-position of the benzimidazole ring can influence its biological activity and solubility. Typically, compounds like this may exhibit properties such as antimicrobial, antifungal, or anticancer activities, making them of interest in drug discovery. The molecular structure suggests that it may interact with biological targets through mechanisms such as enzyme inhibition or receptor modulation. Additionally, the chloroethyl substituent can facilitate alkylation reactions, which are significant in the synthesis of more complex molecules. Overall, the characteristics of this compound make it a subject of interest for further research in various chemical and biological applications.
Formula:C10H11ClN2
InChI:InChI=1S/C10H11ClN2/c1-7-2-3-8-9(6-7)13-10(12-8)4-5-11/h2-3,6H,4-5H2,1H3,(H,12,13)
InChI key:InChIKey=DJFLGANITLDWJR-UHFFFAOYSA-N
SMILES:C(CCl)C=1NC=2C(N1)=CC=C(C)C2
Synonyms:
  • 2-(2-Chloroethyl)-6-methyl-1H-benzimidazole
  • 2-(2-Chloroethyl)-6-methyl-1H-1,3-benzodiazole
  • 1H-Benzimidazole, 2-(2-chloroethyl)-6-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.