CAS 915921-59-4

(6,7-dimethyl-1H-benzimidazol-2-yl)methanol

Description:

(6,7-Dimethyl-1H-benzimidazol-2-yl)methanol is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features two methyl groups at the 6 and 7 positions of the benzimidazole ring, contributing to its hydrophobic character and potentially influencing its biological activity. The presence of a hydroxymethyl group (-CH2OH) at the 2-position enhances its solubility in polar solvents and may facilitate interactions with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for potential hydrogen bonding and interactions with enzymes or receptors, which could be relevant in drug design. Additionally, the specific arrangement of substituents can affect its stability, reactivity, and overall behavior in chemical reactions. As with many organic compounds, its properties can be influenced by factors such as pH, temperature, and the presence of other chemical species.

Formula: C₁₀H₁₂N₂O

InChI: InChI=1/C10H12N2O/c1-6-3-4-8-10(7(6)2)12-9(5-13)11-8/h3-4,13H,5H2,1-2H3,(H,11,12)

SMILES: Cc1ccc2c(c1C)[nH]c(CO)n2

Synonyms:

• (4,5-dimethyl-1H-benzimidazol-2-yl)methanol
• 1H-benzimidazole-2-methanol, 4,5-dimethyl-

(6,7-dimethyl-1H-benzimidazol-2-yl)methanol

CAS: 915921-59-4

Formula: C₁₀H₁₂N₂O

Purity: 95.0%

Molecular weight: 176.219

Ref: 10-F308974