CAS 915921-63-0
:3-[2-(2-piperidyl)ethyl]phenol
Description:
3-[2-(2-Piperidyl)ethyl]phenol, with the CAS number 915921-63-0, is an organic compound characterized by its phenolic structure, which includes a phenol group substituted with a 2-(2-piperidyl)ethyl side chain. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential hydrophobicity due to the phenolic ring and the piperidine moiety. The presence of the piperidine ring suggests that it may have basic properties, allowing it to participate in hydrogen bonding and interact with biological targets. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its solubility characteristics can vary based on the functional groups present, and it may exhibit moderate to high stability under standard conditions. Additionally, the compound's structure may influence its reactivity, making it a candidate for further studies in synthetic applications or as a lead compound in drug discovery.
Formula:C13H19NO
InChI:InChI=1/C13H19NO/c15-13-6-3-4-11(10-13)7-8-12-5-1-2-9-14-12/h3-4,6,10,12,14-15H,1-2,5,7-9H2
SMILES:C1CCNC(C1)CCc1cccc(c1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.