CymitQuimica logo

CAS 915921-64-1

:

3-[(3,3-Dimethyl-1-oxobutyl)amino]-4-methylbenzoic acid

Description:
3-[(3,3-Dimethyl-1-oxobutyl)amino]-4-methylbenzoic acid, identified by its CAS number 915921-64-1, is an organic compound characterized by its unique structure, which includes a benzoic acid moiety substituted with an amino group and a dimethyl-substituted butyl chain. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. The presence of the dimethyl group contributes to steric hindrance, which may influence its reactivity and interactions with biological systems. Additionally, the compound may exhibit acidic behavior due to the carboxylic acid functional group, allowing it to donate protons in solution. Its specific applications and biological activity would depend on its interactions at the molecular level, making it of interest in pharmaceutical and chemical research. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C14H19NO3
InChI:InChI=1S/C14H19NO3/c1-9-5-6-10(13(17)18)7-11(9)15-12(16)8-14(2,3)4/h5-7H,8H2,1-4H3,(H,15,16)(H,17,18)
InChI key:InChIKey=IQZBVCIRKSIHQY-UHFFFAOYSA-N
SMILES:N(C(CC(C)(C)C)=O)C1=CC(C(O)=O)=CC=C1C
Synonyms:
  • Benzoic Acid, 3-[(3,3-Dimethyl-1-Oxobutyl)Amino]-4-Methyl-
  • 3-[(3,3-Dimethyl-1-oxobutyl)amino]-4-methylbenzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.