CAS 915921-66-3

5-[2-(4-methylphenoxy)ethyl]-1,3,4-thiadiazol-2-amine

Description:

5-[2-(4-Methylphenoxy)ethyl]-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and an amine functional group. The presence of the 4-methylphenoxy group contributes to its hydrophobic characteristics, while the thiadiazole moiety is known for its biological activity, often exhibiting antimicrobial or antifungal properties. This compound may be of interest in pharmaceutical research due to its potential applications in drug development. Its molecular structure suggests that it could interact with biological targets, making it a candidate for further investigation in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity would depend on the specific conditions under which it is studied, including pH and temperature. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings. Overall, 5-[2-(4-methylphenoxy)ethyl]-1,3,4-thiadiazol-2-amine represents a class of compounds that may offer valuable insights into therapeutic applications.

Formula: C₁₁H₁₃N₃OS

InChI: InChI=1/C11H13N3OS/c1-8-2-4-9(5-3-8)15-7-6-10-13-14-11(12)16-10/h2-5H,6-7H2,1H3,(H2,12,14)

SMILES: Cc1ccc(cc1)OCCc1n[nH]c(=N)s1