CAS 915921-72-1
:N-[2-(3,5-dimethyl-1-piperidyl)ethyl]propan-2-amine
Description:
N-[2-(3,5-dimethyl-1-piperidyl)ethyl]propan-2-amine, identified by its CAS number 915921-72-1, is a chemical compound that belongs to the class of amines. This substance features a piperidine ring, which is a six-membered ring containing one nitrogen atom, contributing to its basicity and potential for forming hydrogen bonds. The presence of the 3,5-dimethyl substituents on the piperidine ring enhances its steric properties and may influence its biological activity. The propan-2-amine moiety indicates that the compound has a secondary amine structure, which can participate in various chemical reactions, including alkylation and acylation. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of drugs targeting the central nervous system. Its solubility, stability, and reactivity would depend on the specific functional groups and the overall molecular structure, which can affect its interactions in biological systems. As with any chemical substance, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H26N2
InChI:InChI=1/C12H26N2/c1-10(2)13-5-6-14-8-11(3)7-12(4)9-14/h10-13H,5-9H2,1-4H3
SMILES:CC(C)NCCN1CC(C)CC(C)C1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
