CymitQuimica logo

CAS 915921-73-2

:

2-(2,5-dimethylphenoxy)-N-ethylethanamine

Description:
2-(2,5-Dimethylphenoxy)-N-ethylethanamine, identified by its CAS number 915921-73-2, is a chemical compound that features a phenoxy group substituted with two methyl groups at the 2 and 5 positions of the aromatic ring, along with an ethylamine moiety. This structure suggests that it may exhibit properties typical of both aromatic compounds and amines, such as potential hydrophobic characteristics due to the phenyl ring and basicity from the amine group. The presence of the dimethyl substituents can influence its steric and electronic properties, potentially affecting its reactivity and interactions with biological systems. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features. However, specific data regarding its solubility, melting point, boiling point, and biological activity would require further investigation or experimental determination. As with any chemical, safety data and handling precautions should be consulted before use.
Formula:C12H19NO
InChI:InChI=1/C12H19NO/c1-4-13-7-8-14-12-9-10(2)5-6-11(12)3/h5-6,9,13H,4,7-8H2,1-3H3
SMILES:CCNCCOc1cc(C)ccc1C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.