CAS 915921-75-4
:2-(2-chlorophenoxy)-N-ethyl-ethanamine
Description:
2-(2-Chlorophenoxy)-N-ethyl-ethanamine, identified by its CAS number 915921-75-4, is a chemical compound that features a phenoxy group substituted with a chlorine atom and an ethylamine moiety. This compound is characterized by its aromatic structure, which contributes to its potential biological activity. The presence of the chlorophenyl group may enhance lipophilicity, influencing its interaction with biological membranes and receptors. The ethylamine portion suggests potential for amine reactivity, which can be relevant in various chemical reactions or biological interactions. This compound may exhibit properties typical of amines, such as basicity and the ability to form salts. Its specific applications and effects would depend on its interaction with biological systems, making it of interest in medicinal chemistry and pharmacology. As with many chemical substances, safety data and handling precautions are essential, given the potential for toxicity associated with chlorinated compounds. Further research would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C10H14ClNO
InChI:InChI=1/C10H14ClNO/c1-2-12-7-8-13-10-6-4-3-5-9(10)11/h3-6,12H,2,7-8H2,1H3
SMILES:CCNCCOc1ccccc1Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
