CAS 915921-81-2

3-(hydroxymethyl)-4-propoxy-benzaldehyde

Description:

3-(Hydroxymethyl)-4-propoxy-benzaldehyde, with the CAS number 915921-81-2, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a hydroxymethyl group (-CH2OH) and a propoxy group (-O-CH2-CH2-CH3) attached to the benzene ring, contributing to its unique chemical properties. The presence of the hydroxymethyl group enhances its reactivity, allowing for potential participation in various chemical reactions, such as oxidation or condensation. The propoxy group increases the hydrophobic character of the molecule, influencing its solubility in organic solvents. This compound may exhibit interesting biological activities, making it a candidate for research in medicinal chemistry. Its structural features suggest potential applications in the synthesis of more complex organic molecules or as intermediates in the production of pharmaceuticals and agrochemicals. Overall, 3-(hydroxymethyl)-4-propoxy-benzaldehyde is a versatile compound with significant implications in both industrial and research settings.

Formula: C₁₁H₁₄O₃

InChI: InChI=1/C11H14O3/c1-2-5-14-11-4-3-9(7-12)6-10(11)8-13/h3-4,6-7,13H,2,5,8H2,1H3

SMILES: CCCOc1ccc(cc1CO)C=O

3-(Hydroxymethyl)-4-propoxybenzaldehyde

CAS: 915921-81-2

3-(Hydroxymethyl)-4-propoxybenzaldehyde

Purity: 95%

Molecular weight: 194.23g/mol

Ref: 54-OR929438