CAS 915921-85-6

4-[5-(2-Pyrrolidinyl)-1,2,4-oxadiazol-3-yl]pyridine

Description:

4-[5-(2-Pyrrolidinyl)-1,2,4-oxadiazol-3-yl]pyridine is a chemical compound characterized by its unique structure, which includes a pyridine ring and an oxadiazole moiety. The presence of the pyrrolidine group contributes to its potential biological activity, making it of interest in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and may show varying degrees of stability depending on environmental conditions. Its molecular structure suggests potential interactions with biological targets, which could lead to applications in pharmaceuticals, particularly in the development of new therapeutic agents. The oxadiazole ring is known for its role in enhancing the pharmacological properties of compounds, including improved bioactivity and selectivity. As with many heterocyclic compounds, the specific reactivity and interactions of this substance can be influenced by substituents and the overall electronic environment of the molecule. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including drug discovery and development.

Formula: C₁₁H₁₂N₄O

InChI: InChI=1S/C11H12N4O/c1-2-9(13-5-1)11-14-10(15-16-11)8-3-6-12-7-4-8/h3-4,6-7,9,13H,1-2,5H2

InChI key: InChIKey=VSJDOOYVZDYJOU-UHFFFAOYSA-N

SMILES: C1(=NC(=NO1)C=2C=CN=CC2)C3CCCN3

Synonyms:

• 4-[5-(2-Pyrrolidinyl)-1,2,4-oxadiazol-3-yl]pyridine
• Pyridine, 4-[5-(2-pyrrolidinyl)-1,2,4-oxadiazol-3-yl]-