CAS 915921-87-8
:1-(2-chloroethoxy)-2-isopropoxy-benzene
Description:
1-(2-Chloroethoxy)-2-isopropoxy-benzene, identified by its CAS number 915921-87-8, is an organic compound characterized by the presence of a benzene ring substituted with both a chloroethoxy group and an isopropoxy group. The chloroethoxy moiety introduces a chlorine atom and an ethoxy chain, which can influence the compound's reactivity and solubility. The isopropoxy group, derived from isopropanol, contributes to the compound's hydrophobic characteristics and can affect its interactions with other molecules. This compound may exhibit properties typical of aromatic ethers, such as stability under various conditions and potential applications in organic synthesis or as an intermediate in chemical manufacturing. Its specific physical and chemical properties, such as boiling point, melting point, and solubility, would depend on the molecular structure and the nature of the substituents. Additionally, safety and handling considerations should be taken into account due to the presence of chlorine, which can pose health risks.
Formula:C11H15ClO2
InChI:InChI=1/C11H15ClO2/c1-9(2)14-11-6-4-3-5-10(11)13-8-7-12/h3-6,9H,7-8H2,1-2H3
SMILES:CC(C)Oc1ccccc1OCCCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
