CymitQuimica logo

CAS 915921-88-9

:

3-[3-(2-Methylpropyl)-1,2,4-oxadiazol-5-yl]piperidine

Description:
3-[3-(2-Methylpropyl)-1,2,4-oxadiazol-5-yl]piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and an oxadiazole moiety. The presence of the 2-methylpropyl group contributes to its hydrophobic characteristics, potentially influencing its solubility and interaction with biological systems. The oxadiazole ring is known for its stability and can participate in various chemical reactions, making this compound of interest in medicinal chemistry and drug development. The piperidine ring, a six-membered nitrogen-containing heterocycle, is often found in pharmacologically active compounds, contributing to the compound's potential biological activity. This substance may exhibit properties such as moderate to high lipophilicity, which can affect its absorption and distribution in biological systems. Additionally, the specific arrangement of functional groups may impart unique reactivity and binding characteristics, making it a candidate for further research in therapeutic applications. Overall, the compound's structural features suggest potential utility in various chemical and biological contexts.
Formula:C11H19N3O
InChI:InChI=1S/C11H19N3O/c1-8(2)6-10-13-11(15-14-10)9-4-3-5-12-7-9/h8-9,12H,3-7H2,1-2H3
InChI key:InChIKey=APINFVMTWMDIIJ-UHFFFAOYSA-N
SMILES:C(C(C)C)C=1N=C(ON1)C2CCCNC2
Synonyms:
  • 3-[3-(2-Methylpropyl)-1,2,4-oxadiazol-5-yl]piperidine
  • Piperidine, 3-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.