CAS 915921-92-5

2-Ethoxypropanoic acid hydrazide

Description:

2-Ethoxypropanoic acid hydrazide is an organic compound characterized by the presence of both an ethoxy group and a hydrazide functional group. Its molecular structure features a propanoic acid backbone, which is substituted with an ethoxy group at one end and a hydrazide (-NH-NH2) at the other. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydrazide functional group, which can engage in hydrogen bonding. The hydrazide moiety may impart biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the compound may exhibit properties such as moderate stability under standard conditions, but it could be sensitive to hydrolysis or oxidation, depending on the environment. Its reactivity can be influenced by the presence of functional groups, allowing for potential applications in synthesis and as a building block in organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₅H₁₂N₂O₂

InChI: InChI=1S/C5H12N2O2/c1-3-9-4(2)5(8)7-6/h4H,3,6H2,1-2H3,(H,7,8)

InChI key: InChIKey=VDLNPELHFWJZSP-UHFFFAOYSA-N

SMILES: C(C(NN)=O)(OCC)C

Synonyms:

• 2-Ethoxypropanoic acid hydrazide
• Propanoic acid, 2-ethoxy-, hydrazide