CAS 915921-98-1

2-(7-chloro-2,3-dihydro-1,4-benzodioxin-6-yl)acetic acid

Description:

2-(7-chloro-2,3-dihydro-1,4-benzodioxin-6-yl)acetic acid, with the CAS number 915921-98-1, is a chemical compound characterized by its unique structure that includes a benzodioxin moiety and an acetic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which may influence its solubility, reactivity, and biological activity. The presence of the chlorine atom suggests potential for electrophilic substitution reactions, while the dioxin ring contributes to its stability and potential interactions with biological targets. As an acetic acid derivative, it may exhibit acidic properties, allowing it to participate in various chemical reactions, including esterification and salt formation. The compound's specific applications and biological activities would depend on its interactions with biological systems, making it of interest in medicinal chemistry and pharmacology. Overall, its structural features suggest a compound with potential utility in various chemical and biological contexts.

Formula: C₁₀H₉ClO₄

InChI: InChI=1/C10H9ClO4/c11-7-5-9-8(14-1-2-15-9)3-6(7)4-10(12)13/h3,5H,1-2,4H2,(H,12,13)

SMILES: C1COc2cc(c(cc2O1)CC(=O)O)Cl

(7-chloro-2,3-dihydro-1,4-benzodioxin-6-yl)acetic acid

CAS: 915921-98-1

Formula: C₁₀H₉ClO₄

Purity: 95.0%

Molecular weight: 228.63

Ref: 10-F310114