CymitQuimica logo

CAS 915921-99-2

:

2-Chloro-N-[3-(1-pyrrolidinyl)phenyl]acetamide

Description:
2-Chloro-N-[3-(1-pyrrolidinyl)phenyl]acetamide, with the CAS number 915921-99-2, is a chemical compound characterized by its unique structure that includes a chloro group, an acetamide functional group, and a pyrrolidine moiety attached to a phenyl ring. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to its ability to interact with various biological targets. The presence of the chloro substituent can influence its reactivity and stability, while the pyrrolidine ring may contribute to its pharmacological properties. Compounds of this nature are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the specific arrangement of atoms and functional groups can affect the compound's physical properties, such as melting point, boiling point, and spectral characteristics, making it of interest for further research in both synthetic and applied chemistry contexts.
Formula:C12H15ClN2O
InChI:InChI=1S/C12H15ClN2O/c13-9-12(16)14-10-4-3-5-11(8-10)15-6-1-2-7-15/h3-5,8H,1-2,6-7,9H2,(H,14,16)
InChI key:InChIKey=FKUPPGKBFIBLNA-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C=1C=C(C=CC1)N2CCCC2
Synonyms:
  • 2-Chloro-N-[3-(1-pyrrolidinyl)phenyl]acetamide
  • Acetamide, 2-chloro-N-[3-(1-pyrrolidinyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.