CAS 915922-00-8

3-Ethyl-N-(1-methylethyl)-1,2,4-oxadiazole-5-methanamine

Description:

3-Ethyl-N-(1-methylethyl)-1,2,4-oxadiazole-5-methanamine is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of the ethyl and isopropyl groups enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. This compound may exhibit properties typical of oxadiazoles, such as antimicrobial or antifungal activity, although specific biological activities would depend on further empirical studies. The methanamine functional group suggests potential reactivity, allowing for interactions with various biological targets. Additionally, the compound's molecular structure indicates it may participate in hydrogen bonding due to the presence of nitrogen and amine functionalities, which could affect its interactions in chemical and biological environments. As with many synthetic organic compounds, safety and handling precautions should be observed, and its stability under various conditions should be evaluated for practical applications. Further research would be necessary to fully elucidate its properties and potential uses in pharmaceuticals or other fields.

Formula: C₈H₁₅N₃O

InChI: InChI=1S/C8H15N3O/c1-4-7-10-8(12-11-7)5-9-6(2)3/h6,9H,4-5H2,1-3H3

InChI key: InChIKey=IDWQREWRKBJTBS-UHFFFAOYSA-N

SMILES: C(NC(C)C)C1=NC(CC)=NO1

Synonyms:

• 3-Ethyl-N-(1-methylethyl)-1,2,4-oxadiazole-5-methanamine
• 1,2,4-Oxadiazole-5-methanamine, 3-ethyl-N-(1-methylethyl)-

N-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]propan-2-amine

CAS: 915922-00-8

Formula: C₈H₁₅N₃O

Purity: 95.0%

Molecular weight: 169.228

Ref: 10-F309206