CAS 915922-05-3
:2-(1-methylimidazol-2-yl)benzoic acid
Description:
2-(1-Methylimidazol-2-yl)benzoic acid, with the CAS number 915922-05-3, is an organic compound characterized by its unique structure that combines a benzoic acid moiety with a 1-methylimidazole group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The imidazole ring contributes to its potential as a ligand in coordination chemistry, as well as its biological activity, which may include antimicrobial or antifungal properties. The presence of the methyl group on the imidazole enhances its lipophilicity, potentially influencing its interaction with biological membranes. Additionally, the compound may exhibit acidic behavior due to the carboxylic acid group, allowing it to participate in various chemical reactions, including esterification and amidation. Overall, 2-(1-methylimidazol-2-yl)benzoic acid is of interest in both synthetic organic chemistry and medicinal chemistry due to its diverse functional groups and potential applications.
Formula:C11H10N2O2
InChI:InChI=1/C11H10N2O2/c1-13-7-6-12-10(13)8-4-2-3-5-9(8)11(14)15/h2-7H,1H3,(H,14,15)
SMILES:Cn1ccnc1c1ccccc1C(=O)O
Synonyms:- 2-(1-methyl-1H-imidazol-2-yl)benzoic acid
- benzoic acid, 2-(1-methyl-1H-imidazol-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.