CAS 915922-09-7

N-(3-methyl-4-pyridyl)ethane-1,2-diamine

Description:

N-(3-methyl-4-pyridyl)ethane-1,2-diamine, identified by its CAS number 915922-09-7, is an organic compound characterized by its pyridine ring and diamine functional groups. This substance features a 3-methyl-4-pyridyl moiety attached to an ethane backbone with two amine groups at the terminal positions. The presence of the pyridine ring contributes to its aromatic properties, while the amine groups can participate in hydrogen bonding, making it potentially soluble in polar solvents. The compound may exhibit biological activity, as many pyridine derivatives are known for their pharmacological properties. Its structure suggests that it could be involved in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the presence of both the methyl group and the pyridine ring may influence its electronic properties and reactivity. Overall, N-(3-methyl-4-pyridyl)ethane-1,2-diamine is of interest in fields such as medicinal chemistry and materials science due to its unique structural features.

Formula: C₈H₁₃N₃

InChI: InChI=1/C8H13N3/c1-7-6-10-4-2-8(7)11-5-3-9/h2,4,6H,3,5,9H2,1H3,(H,10,11)

SMILES: Cc1c[nH]ccc1=NCCN

N-(3-methylpyridin-4-yl)ethane-1,2-diamine

CAS: 915922-09-7

Formula: C₈H₁₃N₃

Molecular weight: 151.2089

Ref: IN-DA00GVSD

N-(3-methylpyridin-4-yl)ethane-1,2-diamine

CAS: 915922-09-7

Formula: C₈H₁₃N₃

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 151.213

Ref: 10-F309338