CymitQuimica logo

CAS 915922-13-3

:

N-[(1-methylimidazol-2-yl)methyl]propan-1-amine

Description:
N-[(1-methylimidazol-2-yl)methyl]propan-1-amine, with the CAS number 915922-13-3, is a chemical compound characterized by its unique structure that includes a propan-1-amine backbone and a 1-methylimidazole moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. The imidazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry and drug design. The presence of the methyl group on the imidazole enhances its lipophilicity, which can influence its interaction with biological targets. Additionally, the compound may exhibit solubility in polar solvents, and its reactivity can be influenced by the functional groups present. Overall, N-[(1-methylimidazol-2-yl)methyl]propan-1-amine is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C8H15N3
InChI:InChI=1/C8H15N3/c1-3-4-9-7-8-10-5-6-11(8)2/h5-6,9H,3-4,7H2,1-2H3
SMILES:CCCNCc1nccn1C
Synonyms:
  • 1H-imidazole-2-methanamine, 1-methyl-N-propyl-
  • N-[(1-methyl-1H-imidazol-2-yl)methyl]propan-1-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.