CAS 915922-14-4: 4-Methyl-3-(2-oxo-1-imidazolidinyl)benzoic acid

Description: 4-Methyl-3-(2-oxo-1-imidazolidinyl)benzoic acid, identified by its CAS number 915922-14-4, is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with a methyl group and an imidazolidinone ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in polar solvents and moderate stability under standard conditions. The presence of the carboxylic acid functional group suggests acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, the imidazolidinone ring may impart biological activity, making this compound of interest in medicinal chemistry and drug development. Its molecular interactions could be influenced by hydrogen bonding and π-π stacking due to the aromatic system. Overall, 4-Methyl-3-(2-oxo-1-imidazolidinyl)benzoic acid represents a versatile structure with potential applications in pharmaceuticals and organic synthesis.

Formula: C₁₁H₁₂N₂O₃

InChI: InChI=1S/C11H12N2O3/c1-7-2-3-8(10(14)15)6-9(7)13-5-4-12-11(13)16/h2-3,6H,4-5H2,1H3,(H,12,16)(H,14,15)

InChI key: InChIKey=IIIUPHBWZXOBMI-UHFFFAOYSA-N

SMILES: O=C(O)C1=CC=C(C(=C1)N2C(=O)NCC2)C

Synonyms:

• 4-Methyl-3-(2-oxo-1-imidazolidinyl)benzoic acid
• Benzoic acid, 4-methyl-3-(2-oxo-1-imidazolidinyl)-

4-methyl-3-(2-oxoimidazolidin-1-yl)benzoic acid

CAS: 915922-14-4

• Purity: 95.0%
• Color and Shape: Solid
• Molecular weight: 220.22799682617188