CAS 915922-17-7

N1,N1,N2-Trimethyl-1,2-benzenedimethanamine

Description:

N1,N1,N2-Trimethyl-1,2-benzenedimethanamine, identified by its CAS number 915922-17-7, is an organic compound characterized by its amine functional groups and a substituted benzene ring. This compound features a central benzene structure with two methyl groups and two trimethylamine substituents, which contribute to its unique chemical properties. It is typically a colorless to pale yellow liquid, exhibiting a strong amine odor. The presence of multiple methyl groups enhances its solubility in organic solvents while potentially limiting its solubility in water. As a tertiary amine, it can participate in various chemical reactions, including nucleophilic substitutions and complexation with acids. Its applications may extend to fields such as pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, safety data should be consulted, as amines can be irritants and may pose health risks upon exposure. Overall, N1,N1,N2-Trimethyl-1,2-benzenedimethanamine is a versatile compound with distinct chemical characteristics suitable for various applications in chemical research and industry.

Formula: C₁₁H₁₈N₂

InChI: InChI=1S/C11H18N2/c1-12-8-10-6-4-5-7-11(10)9-13(2)3/h4-7,12H,8-9H2,1-3H3

InChI key: InChIKey=PSSOVGAKCZAFMG-UHFFFAOYSA-N

SMILES: C(N(C)C)C1=C(CNC)C=CC=C1

Synonyms:

• 1,2-Benzenedimethanamine, N1,N1,N2-trimethyl-
• N1,N1,N2-Trimethyl-1,2-benzenedimethanamine