
CAS 915922-22-4
:3-(2H-Tetrazol-2-yl)tricyclo[3.3.1.13,7]decan-1-amine
Description:
3-(2H-Tetrazol-2-yl)tricyclo[3.3.1.13,7]decan-1-amine is a chemical compound characterized by its unique tricyclic structure, which incorporates a tetrazole ring. The presence of the tetrazole moiety contributes to its potential as a bioactive compound, often associated with various pharmacological activities, including antimicrobial and anti-inflammatory properties. The tricyclic framework provides rigidity and may influence the compound's interaction with biological targets. This compound is likely to exhibit moderate to high solubility in polar solvents due to the presence of the amine and tetrazole functional groups, which can engage in hydrogen bonding. Additionally, the structural complexity may affect its stability and reactivity, making it of interest in medicinal chemistry and drug design. The CAS number 915922-22-4 serves as a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, the combination of its structural features and functional groups suggests potential utility in various chemical and pharmaceutical applications.
Formula:C11H17N5
InChI:InChI=1S/C11H17N5/c12-10-2-8-1-9(3-10)5-11(4-8,6-10)16-14-7-13-15-16/h7-9H,1-6,12H2
InChI key:InChIKey=GDMMQDDARRYBLP-UHFFFAOYSA-N
SMILES:NC12CC3(CC(C1)CC(C3)C2)N4N=CN=N4
Synonyms:- Tricyclo[3.3.1.13,7]decan-1-amine, 3-(2H-tetrazol-2-yl)-
- 2-(3-Amino-1-adamantyl)tetrazole
- 3-(2H-Tetrazol-2-yl)tricyclo[3.3.1.13,7]decan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.