CAS 915922-23-5

N-methyl-2-(2-methyl-1-piperidyl)ethanamine

Description:

N-methyl-2-(2-methyl-1-piperidyl)ethanamine, identified by its CAS number 915922-23-5, is a chemical compound that belongs to the class of amines. It features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and is substituted with a methyl group and an ethylamine chain. This compound is characterized by its potential biological activity, often studied in the context of pharmacology and medicinal chemistry. Its structure suggests that it may interact with various neurotransmitter systems, making it of interest in research related to neuropharmacology. The presence of the piperidine moiety may influence its lipophilicity and ability to cross biological membranes, which is crucial for its pharmacokinetic properties. Additionally, the compound's synthesis and characterization involve standard organic chemistry techniques, and it may be evaluated for its safety and efficacy in various applications. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, including alkylation and acylation.

Formula: C₉H₂₀N₂

InChI: InChI=1/C9H20N2/c1-9-5-3-4-7-11(9)8-6-10-2/h9-10H,3-8H2,1-2H3

SMILES: CC1CCCCN1CCNC

N-methyl-2-(2-methylpiperidin-1-yl)ethanamine

CAS: 915922-23-5

Formula: C₉H₂₀N₂

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 156.273

Ref: 10-F309499