CAS 915922-24-6

5-(5-Methyl-3-thienyl)-1,3,4-oxadiazol-2-amine

Description:

5-(5-Methyl-3-thienyl)-1,3,4-oxadiazol-2-amine is a chemical compound characterized by its unique structure, which includes an oxadiazole ring and a thienyl group. The oxadiazole moiety contributes to its potential as a bioactive compound, often associated with various pharmacological activities. The presence of the thienyl group, which is a sulfur-containing heterocycle, can enhance the compound's lipophilicity and influence its interaction with biological targets. This compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, making it of interest in medicinal chemistry. Its molecular structure allows for potential modifications that could lead to derivatives with improved efficacy or selectivity. Additionally, the compound's stability, solubility, and reactivity are influenced by the functional groups present, which are critical for its application in drug development or as a research tool in various chemical and biological studies. Overall, 5-(5-Methyl-3-thienyl)-1,3,4-oxadiazol-2-amine represents a class of compounds that are being explored for their therapeutic potential.

Formula: C₇H₇N₃OS

InChI: InChI=1S/C7H7N3OS/c1-4-2-5(3-12-4)6-9-10-7(8)11-6/h2-3H,1H3,(H2,8,10)

InChI key: InChIKey=QMGRQOMIDRJTIO-UHFFFAOYSA-N

SMILES: CC1=CC(=CS1)C=2OC(N)=NN2

Synonyms:

• 1,3,4-Oxadiazol-2-amine, 5-(5-methyl-3-thienyl)-
• 5-(5-Methyl-3-thienyl)-1,3,4-oxadiazol-2-amine