CymitQuimica logo

CAS 915922-25-7

:

3-Hydrazinyl-5-(3-methoxyphenyl)-1,2,4-triazine

Description:
3-Hydrazinyl-5-(3-methoxyphenyl)-1,2,4-triazine is a chemical compound characterized by its triazine core, which is a six-membered heterocyclic ring containing three nitrogen atoms. This compound features a hydrazinyl group (-NH-NH2) at the 3-position and a 3-methoxyphenyl group at the 5-position, contributing to its unique reactivity and potential biological activity. The presence of the methoxy group (-OCH3) enhances its lipophilicity, which may influence its solubility and interaction with biological systems. The hydrazinyl moiety is known for its ability to form hydrazones and can participate in various chemical reactions, making this compound of interest in medicinal chemistry and drug development. Additionally, the triazine structure is often associated with diverse pharmacological properties, including antitumor and antimicrobial activities. Overall, 3-Hydrazinyl-5-(3-methoxyphenyl)-1,2,4-triazine represents a versatile scaffold for further chemical modifications and potential therapeutic applications.
Formula:C10H11N5O
InChI:InChI=1S/C10H11N5O/c1-16-8-4-2-3-7(5-8)9-6-12-15-10(13-9)14-11/h2-6H,11H2,1H3,(H,13,14,15)
InChI key:InChIKey=VFQKUNUNUMFNQG-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1)C=2NC(=NN)N=NC2
Synonyms:
  • 3-Hydrazinyl-5-(3-methoxyphenyl)-1,2,4-triazine
  • 1,2,4-Triazine, 3-hydrazinyl-5-(3-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.