
CAS 915922-26-8
:N-Cyclopentyl-3-methylcyclohexanamine
Description:
N-Cyclopentyl-3-methylcyclohexanamine, with the CAS number 915922-26-8, is a chemical compound that belongs to the class of amines. It features a cyclohexane ring substituted with a methyl group and a cyclopentyl group, which contributes to its unique structural characteristics. This compound is typically characterized by its moderate polarity, which can influence its solubility in various solvents. The presence of the amine functional group suggests potential basicity and reactivity, particularly in forming salts or engaging in nucleophilic reactions. Additionally, the steric hindrance introduced by the cyclopentyl and methyl groups may affect its biological activity and interaction with other molecules. While specific physical properties such as melting point, boiling point, and density are not provided, compounds of this nature often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry and drug development. As with many amines, safety precautions should be taken when handling this compound due to potential toxicity and reactivity.
Formula:C12H23N
InChI:InChI=1S/C12H23N/c1-10-5-4-8-12(9-10)13-11-6-2-3-7-11/h10-13H,2-9H2,1H3
InChI key:InChIKey=ZAYHAPKVIWMDAG-UHFFFAOYSA-N
SMILES:N(C1CC(C)CCC1)C2CCCC2
Synonyms:- Cyclohexanamine, N-cyclopentyl-3-methyl-
- N-Cyclopentyl-3-methylcyclohexanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.