CAS 915922-40-6

(3-bromo-4-propoxy-phenyl)methanol

Description:

(3-bromo-4-propoxy-phenyl)methanol, with the CAS number 915922-40-6, is an organic compound characterized by its phenolic structure, which includes a bromine atom and a propoxy group attached to a phenyl ring. The presence of the bromine substituent typically enhances the compound's reactivity, making it useful in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The propoxy group contributes to the compound's hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, the hydroxyl (-OH) group in the methanol part of the molecule provides potential for hydrogen bonding, affecting its physical properties, such as boiling point and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis and application can be explored in various fields, including pharmaceuticals and materials science, due to the functional groups present that allow for further chemical modifications.

Formula: C₁₀H₁₃BrO₂

InChI: InChI=1/C10H13BrO2/c1-2-5-13-10-4-3-8(7-12)6-9(10)11/h3-4,6,12H,2,5,7H2,1H3

SMILES: CCCOc1ccc(cc1Br)CO