CAS 915922-44-0
:3-(4-bromophenoxy)-N-methylpropan-1-amine
Description:
3-(4-bromophenoxy)-N-methylpropan-1-amine, with the CAS number 915922-44-0, is an organic compound characterized by its structure, which includes a bromophenoxy group and a N-methylpropan-1-amine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. The bromophenoxy substituent can influence its solubility and reactivity, often enhancing lipophilicity due to the bromine atom's electron-withdrawing nature. This compound may also demonstrate biological activity, potentially acting as a ligand for various receptors or enzymes, which is common for amine-containing compounds. Its synthesis and application could be relevant in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if ingested or inhaled.
Formula:C10H14BrNO
InChI:InChI=1/C10H14BrNO/c1-12-7-2-8-13-10-5-3-9(11)4-6-10/h3-6,12H,2,7-8H2,1H3
SMILES:CNCCCOc1ccc(cc1)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.