CAS 915922-50-8
:1-(methylsulfonyl)-1H-benzimidazol-2-amine
Description:
1-(Methylsulfonyl)-1H-benzimidazol-2-amine, identified by its CAS number 915922-50-8, is a chemical compound that features a benzimidazole core substituted with a methylsulfonyl group and an amino group. This compound typically exhibits characteristics common to benzimidazole derivatives, such as potential biological activity, including antimicrobial and anti-inflammatory properties. The presence of the methylsulfonyl group enhances its solubility and may influence its pharmacokinetic properties. The amino group can participate in hydrogen bonding, which may affect its interaction with biological targets. This compound is of interest in medicinal chemistry and drug development due to its structural features that may contribute to its efficacy in various therapeutic applications. Additionally, its stability and reactivity can be influenced by the electronic effects of the substituents on the benzimidazole ring. Overall, 1-(methylsulfonyl)-1H-benzimidazol-2-amine represents a class of compounds that are being explored for their potential utility in treating various diseases.
Formula:C8H9N3O2S
InChI:InChI=1/C8H9N3O2S/c1-14(12,13)11-7-5-3-2-4-6(7)10-8(11)9/h2-5H,1H3,(H2,9,10)
SMILES:CS(=O)(=O)n1c2ccccc2[nH]c1=N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.