CAS 915922-51-9
:N-(3-methylbenzyl)propan-2-amine
Description:
N-(3-methylbenzyl)propan-2-amine, identified by its CAS number 915922-51-9, is an organic compound characterized by its amine functional group and a propan-2-amine backbone. This substance features a 3-methylbenzyl group, which contributes to its hydrophobic characteristics, making it less soluble in water compared to more polar amines. The presence of the propan-2-amine structure indicates that it has a secondary amine, which can participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. The compound may exhibit biological activity, potentially interacting with neurotransmitter systems, although specific pharmacological properties would require further investigation. Its molecular structure suggests it could be used in various applications, including pharmaceuticals or as a building block in organic synthesis. Safety and handling precautions should be observed, as with all amines, due to potential irritant properties and the need for proper storage conditions to maintain stability.
Formula:C11H17N
InChI:InChI=1/C11H17N/c1-9(2)12-8-11-6-4-5-10(3)7-11/h4-7,9,12H,8H2,1-3H3
SMILES:CC(C)NCc1cccc(C)c1
Synonyms:- [(3-Methylphenyl)Methyl](Propan-2-Yl)Amine
- benzenemethanamine, 3-methyl-N-(1-methylethyl)-
- N-(3-Methylbenzyl)propan-2-amineN-(3-Methylphenylmethyl)isopropylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.