CymitQuimica logo

CAS 915922-56-4

:

2-methyl-2-(thiophene-2-carbonylamino)propanoic acid

Description:
2-Methyl-2-(thiophene-2-carbonylamino)propanoic acid is an organic compound characterized by its unique structure, which includes a propanoic acid backbone with a methyl group and a thiophene ring substituted at specific positions. This compound features a carbonyl group attached to the thiophene, contributing to its potential reactivity and interactions in various chemical environments. The presence of the thiophene moiety may impart interesting electronic properties, making it relevant in fields such as organic electronics or pharmaceuticals. The carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit solubility in polar solvents. Additionally, the compound's structure may allow for hydrogen bonding, influencing its physical properties such as melting point and solubility. Overall, 2-methyl-2-(thiophene-2-carbonylamino)propanoic acid is a compound of interest due to its potential applications in synthetic chemistry and material science, although specific data on its reactivity and applications would require further investigation.
Formula:C9H11NO3S
InChI:InChI=1/C9H11NO3S/c1-9(2,8(12)13)10-7(11)6-4-3-5-14-6/h3-5H,1-2H3,(H,10,11)(H,12,13)
SMILES:CC(C)(C(=O)O)NC(=O)c1cccs1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.