
CAS 915922-62-2
:N-(5-Formyl-2-pyrimidinyl)benzenesulfonamide
Description:
N-(5-Formyl-2-pyrimidinyl)benzenesulfonamide is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a sulfonamide group. The presence of the formyl group at the 5-position of the pyrimidine ring contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is likely to exhibit polar characteristics due to the sulfonamide functional group, which can engage in hydrogen bonding, influencing its solubility in various solvents. Additionally, the aromatic nature of the benzenesulfonamide moiety may impart stability and facilitate interactions with biological targets, making it of interest in drug development. The compound's molecular structure suggests potential for various chemical reactions, including condensation and substitution, which can be exploited in synthetic pathways. Overall, N-(5-Formyl-2-pyrimidinyl)benzenesulfonamide represents a versatile building block in the realm of organic chemistry, with implications for further research and application in pharmaceuticals.
Formula:C11H9N3O3S
InChI:InChI=1S/C11H9N3O3S/c15-8-9-6-12-11(13-7-9)14-18(16,17)10-4-2-1-3-5-10/h1-8H,(H,12,13,14)
InChI key:InChIKey=OCTVVGLDWYABAC-UHFFFAOYSA-N
SMILES:S(NC=1N=CC(C=O)=CN1)(=O)(=O)C2=CC=CC=C2
Synonyms:- Benzenesulfonamide, N-(5-formyl-2-pyrimidinyl)-
- N-(5-Formyl-2-pyrimidinyl)benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.