CAS 915922-65-5
:N-(4-Hydroxyphenyl)-5-methyl-2-furancarboxamide
Description:
N-(4-Hydroxyphenyl)-5-methyl-2-furancarboxamide, with the CAS number 915922-65-5, is a chemical compound characterized by its unique structure that includes a furan ring, a carboxamide group, and a hydroxyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its solubility, stability, and reactivity. The presence of the hydroxyl group suggests potential for hydrogen bonding, which can enhance its solubility in polar solvents. Additionally, the furan ring contributes to its aromatic character, potentially affecting its electronic properties and reactivity in various chemical reactions. This compound may also exhibit biological activity, making it of interest in pharmaceutical and medicinal chemistry. Its specific applications and behavior in different environments would depend on further studies, including its interaction with biological systems and its stability under various conditions. Overall, N-(4-Hydroxyphenyl)-5-methyl-2-furancarboxamide represents a compound with diverse potential applications in research and industry.
Formula:C12H11NO3
InChI:InChI=1S/C12H11NO3/c1-8-2-7-11(16-8)12(15)13-9-3-5-10(14)6-4-9/h2-7,14H,1H3,(H,13,15)
InChI key:InChIKey=UQMNRQHIORVLKD-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(O)C=C1)(=O)C2=CC=C(C)O2
Synonyms:- 2-Furancarboxamide, N-(4-hydroxyphenyl)-5-methyl-
- N-(4-Hydroxyphenyl)-5-methyl-2-furancarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.