CAS 915922-67-7
:N-methyl-1-(5-methyl-1H-indol-3-yl)methanamine
Description:
N-methyl-1-(5-methyl-1H-indol-3-yl)methanamine, with the CAS number 915922-67-7, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a methyl group at the 5-position of the indole ring and a methanamine functional group, indicating the presence of both amine and methyl substituents. The presence of the indole moiety suggests potential biological activity, as indole derivatives are often associated with various pharmacological properties. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic indole structure. Its molecular structure may allow for interactions with biological targets, making it of interest in medicinal chemistry. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise values.
Formula:C11H14N2
InChI:InChI=1/C11H14N2/c1-8-3-4-11-10(5-8)9(6-12-2)7-13-11/h3-5,7,12-13H,6H2,1-2H3
SMILES:Cc1ccc2c(c1)c(CNC)c[nH]2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
