CAS 915922-68-8

5-(3,4-dihydroisoquinolin-2(1H)-ylmethyl)furan-2-carboxylic acid

Description:

5-(3,4-Dihydroisoquinolin-2(1H)-ylmethyl)furan-2-carboxylic acid is a chemical compound characterized by its unique structure, which includes a furan ring and an isoquinoline moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the furan ring suggests potential reactivity and interactions typical of heterocyclic compounds, while the isoquinoline structure may impart biological activity, making it of interest in medicinal chemistry. The compound's molecular framework allows for various potential applications, including in drug development and synthesis of biologically active molecules. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions, including pH and solvent. Additionally, the compound's CAS number, 915922-68-8, serves as a unique identifier for regulatory and research purposes, facilitating its study and application in various scientific fields. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.

Formula: C₁₅H₁₅NO₃

InChI: InChI=1/C15H15NO3/c17-15(18)14-6-5-13(19-14)10-16-8-7-11-3-1-2-4-12(11)9-16/h1-6H,7-10H2,(H,17,18)

SMILES: c1ccc2CN(CCc2c1)Cc1ccc(C(=O)O)o1

Synonyms:

• 5-(3,4-Dihydroisoquinolin-2(1H)-ylmethyl)-2-furoic acid

5-(3,4-dihydro-2(1H)-isoquinolinylmethyl)-2-furoic acid

CAS: 915922-68-8

Purity: 95.0%

Molecular weight: 257.28900146484375

Ref: 10-F315646