CAS 915922-69-9

5-(4-Morpholinylphenylmethyl)-1H-tetrazole-1-acetic acid

Description:

5-(4-Morpholinylphenylmethyl)-1H-tetrazole-1-acetic acid is a chemical compound characterized by its unique structure, which includes a tetrazole ring and a morpholine moiety. This compound typically exhibits properties such as solubility in polar solvents, which is common for compounds containing carboxylic acid groups. The presence of the morpholine group may contribute to its potential as a pharmacophore, suggesting possible biological activity, particularly in medicinal chemistry. The tetrazole ring is known for its stability and ability to participate in various chemical reactions, making this compound of interest in drug development and synthesis. Additionally, the compound may exhibit specific pKa values due to the carboxylic acid functionality, influencing its ionization state in different pH environments. Overall, the characteristics of this compound suggest potential applications in pharmaceuticals, particularly in areas requiring compounds with specific biological interactions or properties.

Formula: C₁₄H₁₇N₅O₃

InChI: InChI=1S/C14H17N5O3/c20-12(21)10-19-14(15-16-17-19)13(11-4-2-1-3-5-11)18-6-8-22-9-7-18/h1-5,13H,6-10H2,(H,20,21)

InChI key: InChIKey=WJCGZMJZBWYCBG-UHFFFAOYSA-N

SMILES: C(C=1N(CC(O)=O)N=NN1)(C2=CC=CC=C2)N3CCOCC3

Synonyms:

• 1H-Tetrazole-1-acetic acid, 5-(4-morpholinylphenylmethyl)-
• 5-(4-Morpholinylphenylmethyl)-1H-tetrazole-1-acetic acid

{5-[morpholin-4-yl(phenyl)methyl]-1H-tetrazol-1-yl}acetic acid

CAS: 915922-69-9

Formula: C₁₄H₁₇N₅O₃

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 303.322

Ref: 10-F313741