CAS 915922-71-3

N-methyl-1-(3-methylsulfanylphenyl)methanamine

Description:

N-methyl-1-(3-methylsulfanylphenyl)methanamine, identified by its CAS number 915922-71-3, is an organic compound characterized by its amine functional group and a methylsulfanyl substituent on a phenyl ring. This compound features a central carbon atom bonded to a methyl group, an amine group, and a phenyl group that is further substituted with a methylsulfanyl group, which introduces sulfur into its structure. The presence of the methylsulfanyl group can influence the compound's reactivity and solubility, potentially enhancing its lipophilicity. As an amine, it may exhibit basic properties and can participate in various chemical reactions, including alkylation and acylation. The compound's structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis, although specific applications would depend on further research into its biological activity and chemical behavior. Safety data and handling precautions should be considered, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₉H₁₃NS

InChI: InChI=1/C9H13NS/c1-10-7-8-4-3-5-9(6-8)11-2/h3-6,10H,7H2,1-2H3

SMILES: CNCc1cccc(c1)SC

N-methyl-1-[3-(methylthio)phenyl]methanamine

CAS: 915922-71-3

Formula: C₉H₁₃NS

Purity: 95.0%

Molecular weight: 167.27

Ref: 10-F308259

Methyl({[3-(methylsulfanyl)phenyl]methyl})amine

CAS: 915922-71-3

Versatile small molecule scaffold

Formula: C₉H₁₃NS

Purity: Min. 95%

Molecular weight: 167.27 g/mol

Ref: 3D-QLB92271