CAS 915922-80-4

4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline

Description:

4-[3-(4-Methylphenyl)-1,2,4-oxadiazol-5-yl]aniline, with the CAS number 915922-80-4, is an organic compound characterized by its complex structure that includes an aniline moiety and a 1,2,4-oxadiazole ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential stability under standard laboratory conditions. The presence of the oxadiazole ring suggests that it may possess interesting electronic properties, which could make it useful in applications such as organic electronics or as a fluorescent probe. Additionally, the methylphenyl substituent can influence its reactivity and interaction with other chemical species. The compound may also exhibit biological activity, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods like recrystallization or chromatography. Overall, 4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline represents a class of compounds that can be explored for various chemical and biological applications.

Formula: C₁₅H₁₃N₃O

InChI: InChI=1/C15H13N3O/c1-10-2-4-11(5-3-10)14-17-15(19-18-14)12-6-8-13(16)9-7-12/h2-9H,16H2,1H3

SMILES: Cc1ccc(cc1)c1nc(c2ccc(cc2)N)on1

Synonyms:

• Benzenamine, 4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-
• 4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline(SALTDATA: FREE)
• 4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline