CAS 915922-81-5

1-[3-(Aminomethyl)-1-piperidinyl]ethanone

Description:

1-[3-(Aminomethyl)-1-piperidinyl]ethanone, with the CAS number 915922-81-5, is a chemical compound characterized by its piperidine structure, which includes an aminomethyl group attached to the piperidine ring. This compound typically exhibits properties associated with amines and ketones, such as basicity and potential reactivity in nucleophilic substitution reactions. The presence of the piperidine moiety suggests that it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. Additionally, the compound may exhibit solubility in polar solvents, which is common for amine-containing compounds. Its molecular structure allows for various functional group transformations, making it a versatile intermediate in organic synthesis. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential hazards associated with its use. Overall, 1-[3-(Aminomethyl)-1-piperidinyl]ethanone represents a significant compound in the realm of organic and medicinal chemistry.

Formula: C₈H₁₆N₂O

InChI: InChI=1S/C8H16N2O/c1-7(11)10-4-2-3-8(5-9)6-10/h8H,2-6,9H2,1H3

InChI key: InChIKey=UWOMLUIOZZSCPN-UHFFFAOYSA-N

SMILES: C(C)(=O)N1CC(CN)CCC1

Synonyms:

• 1-Acetyl-3-aminomethylpiperidine
• Ethanone, 1-[3-(aminomethyl)-1-piperidinyl]-
• 1-[3-(Aminomethyl)piperidin-1-yl]ethanone
• 1-[3-(Aminomethyl)-1-piperidinyl]ethanone
• 1-[3-(Aminomethyl)piperidin-1-yl]ethan-1-one