CAS 915922-82-6
:3-(4-Methylphenyl)-1,2,4-oxadiazole-5-ethanamine
Description:
3-(4-Methylphenyl)-1,2,4-oxadiazole-5-ethanamine is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a 4-methylphenyl group, which contributes to its aromatic properties and may influence its solubility and reactivity. The presence of an ethanamine functional group suggests potential for hydrogen bonding and reactivity in various chemical environments. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure can lead to diverse interactions with biological targets, potentially influencing pharmacological properties. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 3-(4-Methylphenyl)-1,2,4-oxadiazole-5-ethanamine represents a class of compounds that may have applications in pharmaceuticals or materials science, warranting further investigation into its properties and potential uses.
Formula:C11H13N3O
InChI:InChI=1S/C11H13N3O/c1-8-2-4-9(5-3-8)11-13-10(6-7-12)15-14-11/h2-5H,6-7,12H2,1H3
InChI key:InChIKey=IAKNVFODBBNBHI-UHFFFAOYSA-N
SMILES:C(CN)C1=NC(=NO1)C2=CC=C(C)C=C2
Synonyms:- 2-[3-(4-Methylphenyl)-1,2,4-oxadiazol-5-yl]ethanamine
- 3-(4-Methylphenyl)-1,2,4-oxadiazole-5-ethanamine
- 2-[3-(4-Methylphenyl)-1,2,4-oxadiazol-5-yl]ethan-1-amine
- 1,2,4-Oxadiazole-5-ethanamine, 3-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
