CAS 915922-90-6
:4-[3-(3-Methylphenyl)-1,2,4-oxadiazol-5-yl]benzenamine
Description:
4-[3-(3-Methylphenyl)-1,2,4-oxadiazol-5-yl]benzenamine, with the CAS number 915922-90-6, is an organic compound characterized by its complex structure, which includes an oxadiazole ring and an aniline moiety. This compound features a 1,2,4-oxadiazole group, known for its potential biological activity, particularly in medicinal chemistry. The presence of the 3-methylphenyl substituent contributes to its hydrophobic characteristics, which can influence its solubility and interaction with biological systems. The amine functional group in the benzenamine part of the molecule can participate in hydrogen bonding, making it a potential candidate for various chemical reactions and applications. Additionally, compounds with similar structures often exhibit interesting photophysical properties, which can be harnessed in materials science and organic electronics. Overall, the unique combination of functional groups in this compound suggests potential utility in pharmaceuticals or as a building block in organic synthesis. Further studies would be necessary to fully elucidate its properties and applications.
Formula:C15H13N3O
InChI:InChI=1/C15H13N3O/c1-10-3-2-4-12(9-10)14-17-15(19-18-14)11-5-7-13(16)8-6-11/h2-9H,16H2,1H3
InChI key:InChIKey=QRLNLRHSHPXWCD-UHFFFAOYSA-N
SMILES:NC1=CC=C(C2=NC(=NO2)C3=CC(C)=CC=C3)C=C1
Synonyms:- Benzenamine, 4-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]-
- 4-[3-(3-Methylphenyl)-1,2,4-oxadiazol-5-yl]aniline
- 4-[3-(3-Methylphenyl)-1,2,4-oxadiazol-5-yl]benzenamine
- 4-(3-(M-tolyl)-1,2,4-oxadiazol-5-yl)aniline
- 4-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline(SALTDATA: FREE)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.