CymitQuimica logo

CAS 915922-92-8

:

2-[3-(o-tolyl)-1,2,4-oxadiazol-5-yl]aniline

Description:
2-[3-(o-Tolyl)-1,2,4-oxadiazol-5-yl]aniline, with the CAS number 915922-92-8, is an organic compound characterized by its complex structure that includes an aniline moiety and an oxadiazole ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential stability under standard laboratory conditions. The presence of the oxadiazole ring contributes to its potential applications in materials science and pharmaceuticals, particularly due to its electronic properties and ability to participate in various chemical reactions. The o-tolyl group enhances its hydrophobic characteristics, which may influence its interaction with biological systems or other chemical entities. Additionally, the compound may exhibit fluorescence or other photophysical properties, making it of interest in the development of sensors or imaging agents. Overall, 2-[3-(o-tolyl)-1,2,4-oxadiazol-5-yl]aniline is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C15H13N3O
InChI:InChI=1/C15H13N3O/c1-10-6-2-3-7-11(10)14-17-15(19-18-14)12-8-4-5-9-13(12)16/h2-9H,16H2,1H3
SMILES:Cc1ccccc1c1nc(c2ccccc2N)on1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.