CAS 915923-02-3
:2-(3-Bromophenoxy)propanamide
Description:
2-(3-Bromophenoxy)propanamide is an organic compound characterized by its amide functional group and a bromophenyl moiety. It features a propanamide backbone, where a bromophenoxy group is attached to the second carbon of the propanamide chain. The presence of the bromine atom on the aromatic ring enhances the compound's reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic component, while the amide group can engage in hydrogen bonding, potentially affecting its solubility in polar solvents. Additionally, the compound may possess specific pharmacological properties, which could be explored in drug development contexts. Its molecular structure suggests potential applications in various fields, including agrochemicals and pharmaceuticals, where the bromophenyl group may contribute to the compound's efficacy. As with many organic compounds, safety and handling precautions should be observed, given the presence of bromine, which can be hazardous.
Formula:C9H10BrNO2
InChI:InChI=1S/C9H10BrNO2/c1-6(9(11)12)13-8-4-2-3-7(10)5-8/h2-6H,1H3,(H2,11,12)
InChI key:InChIKey=VKSQANBMBJUCNQ-UHFFFAOYSA-N
SMILES:O(C(C(N)=O)C)C1=CC(Br)=CC=C1
Synonyms:- 2-(3-Bromo-phenoxy)-propionamide
- Propanamide, 2-(3-Bromophenoxy)-
- 2-(3-Bromophenoxy)propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
