CAS 915923-14-7

3-[(2-ethylbutanoyl)amino]-4-methylbenzoic acid

Description:

3-[(2-Ethylbutanoyl)amino]-4-methylbenzoic acid, identified by its CAS number 915923-14-7, is an organic compound characterized by its complex structure that includes both an aromatic ring and an amide functional group. This compound features a benzoic acid moiety, which contributes to its acidity and potential reactivity. The presence of the 2-ethylbutanoyl group indicates that it has a branched alkyl chain, which can influence its solubility and hydrophobic properties. The methyl group at the 4-position of the benzene ring adds steric hindrance, potentially affecting its interactions with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility characteristics would likely vary depending on the solvent used, and it may participate in various chemical reactions typical of carboxylic acids and amides. Overall, the unique combination of functional groups and structural features makes this compound a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₄H₁₉NO₃

InChI: InChI=1/C14H19NO3/c1-4-10(5-2)13(16)15-12-8-11(14(17)18)7-6-9(12)3/h6-8,10H,4-5H2,1-3H3,(H,15,16)(H,17,18)

SMILES: CCC(CC)C(=Nc1cc(ccc1C)C(=O)O)O

Synonyms:

• 3-(2-Ethylbutanamido)-4-Methylbenzoic Acid

3-[(2-ethylbutanoyl)amino]-4-methylbenzoic acid

CAS: 915923-14-7

Formula: C₁₄H₁₉NO₃

Purity: 95.0%

Molecular weight: 249.31

Ref: 10-F315942