CAS 915923-15-8
:2-(2-Methoxyphenyl)-5-thiazolecarboxaldehyde
Description:
2-(2-Methoxyphenyl)-5-thiazolecarboxaldehyde is an organic compound characterized by its thiazole and aldehyde functional groups. The thiazole ring contributes to its heterocyclic nature, which can influence its reactivity and biological activity. The presence of the methoxyphenyl group enhances its lipophilicity, potentially affecting its solubility and interaction with biological membranes. This compound may exhibit various chemical properties, including reactivity towards nucleophiles due to the aldehyde group, which can participate in condensation reactions. Additionally, the thiazole moiety can engage in coordination with metal ions, making it of interest in coordination chemistry. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as thiazole derivatives are often associated with diverse biological activities. Overall, 2-(2-Methoxyphenyl)-5-thiazolecarboxaldehyde is a compound of interest for further research in both synthetic and applied chemistry contexts.
Formula:C11H9NO2S
InChI:InChI=1S/C11H9NO2S/c1-14-10-5-3-2-4-9(10)11-12-6-8(7-13)15-11/h2-7H,1H3
InChI key:InChIKey=SNBBZSLDMOLYHA-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1)C=2SC(C=O)=CN2
Synonyms:- 2-(2-Methoxyphenyl)-1,3-Thiazole-5-Carbaldehyde
- 2-(2-Methoxyphenyl)-5-thiazolecarboxaldehyde
- 5-Thiazolecarboxaldehyde, 2-(2-Methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
